C21H20FNO6 — CID 46805567
[2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 46805567) has the molecular formula C21H20FNO6 and a molecular weight of 401.39 g/mol. Its IUPAC name is [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46805567 |
| Molecular Formula | C21H20FNO6 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)c2ccc(NC(C)=O)cc2F)cc1OC |
| InChI | InChI=1S/C21H20FNO6/c1-13(24)23-15-6-7-16(17(22)11-15)18(25)12-29-21(26)9-5-14-4-8-19(27-2)20(10-14)28-3/h4-11H,12H2,1-3H3,(H,23,24)/b9-5+ |
| InChIKey | VRIUBEZKPSDRFY-WEVVVXLNSA-N |
| XLogP | 3.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|