C16H14ClF2NO4S — CID 46814981
[2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 3-thiophen-3-ylpropanoate (PubChem CID 46814981) has the molecular formula C16H14ClF2NO4S and a molecular weight of 389.81 g/mol. Its IUPAC name is [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 46814981 |
| Molecular Formula | C16H14ClF2NO4S |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccsc1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClF2NO4S/c17-12-7-11(2-3-13(12)24-16(18)19)20-14(21)8-23-15(22)4-1-10-5-6-25-9-10/h2-3,5-7,9,16H,1,4,8H2,(H,20,21) |
| InChIKey | BRNXWYBUZPFOGG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |