C21H20FNO5 — CID 46816547
3-(4-fluorophenoxy)propyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46816547) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 3-(4-fluorophenoxy)propyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46816547 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(C(C)C(=O)OCCCOc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C21H20FNO5/c1-13-4-9-17-18(12-13)20(25)23(19(17)24)14(2)21(26)28-11-3-10-27-16-7-5-15(22)6-8-16/h4-9,12,14H,3,10-11H2,1-2H3 |
| InChIKey | KKBCXNOQFBIOAM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|