C20H21FN2O5 — CID 46816794
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 46816794) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-[(4-fluorophenyl)methoxy]benzoate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-[(4-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 46816794 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 3-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | CC(C)C(OC(=O)c1cccc(OCc2ccc(F)cc2)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C20H21FN2O5/c1-12(2)17(18(24)23-20(22)26)28-19(25)14-4-3-5-16(10-14)27-11-13-6-8-15(21)9-7-13/h3-10,12,17H,11H2,1-2H3,(H3,22,23,24,26) |
| InChIKey | LZNRZKZEZVWQLF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |