About prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate
prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 91681581) has the molecular formula C17H13FO3
and a molecular weight of 284.29 g/mol. Its IUPAC name is prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate.
Molecular Properties
| Compound Name | prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate |
| PubChem CID | 91681581 |
| Molecular Formula | C17H13FO3 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | C#CCOC(=O)c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H13FO3/c1-2-10-20-17(19)14-4-3-5-16(11-14)21-12-13-6-8-15(18)9-7-13/h1,3-9,11H,10,12H2 |
| InChIKey | RLZRVOVZHKSFLX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate?
The IUPAC name of prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate (CID 91681581) is prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate.
What is the SMILES notation for prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate?
The canonical SMILES for prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate is C#CCOC(=O)c1cccc(OCc2ccc(F)cc2)c1.
What is the InChIKey of prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate?
The InChIKey is RLZRVOVZHKSFLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FO3/c1-2-10-20-17(19)14-4-3-5-16(11-14)21-12-13-6-8-15(18)9-7-13/h1,3-9,11H,10,12H2.
What are the key properties of prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate?
prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate has a molecular weight of 284.29 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 3-[(4-fluorophenyl)methoxy]benzoate is sourced from PubChem (CID 91681581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).