C24H29N3O3S2 — CID 46819861
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 46819861) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 46819861 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-methyl-5-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2C)cc1C(=O)NCCSCc1ccccc1C#N |
| InChI | InChI=1S/C24H29N3O3S2/c1-18-10-11-22(32(29,30)27-13-6-5-7-19(27)2)15-23(18)24(28)26-12-14-31-17-21-9-4-3-8-20(21)16-25/h3-4,8-11,15,19H,5-7,12-14,17H2,1-2H3,(H,26,28) |
| InChIKey | SOMRSPPDHDRSAX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|