About [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate
[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 46826731) has the molecular formula C20H17NO3S2
and a molecular weight of 383.49 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| PubChem CID | 46826731 |
| Molecular Formula | C20H17NO3S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)OCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H17NO3S2/c22-17(15-7-6-13-3-1-4-14(13)9-15)11-24-19(23)10-16-12-26-20(21-16)18-5-2-8-25-18/h2,5-9,12H,1,3-4,10-11H2 |
| InChIKey | BYVICZDFNAIZDX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate?
The IUPAC name of [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (CID 46826731) is [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate?
The canonical SMILES for [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate is O=C(Cc1csc(-c2cccs2)n1)OCC(=O)c1ccc2c(c1)CCC2.
What is the InChIKey of [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate?
The InChIKey is BYVICZDFNAIZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO3S2/c22-17(15-7-6-13-3-1-4-14(13)9-15)11-24-19(23)10-16-12-26-20(21-16)18-5-2-8-25-18/h2,5-9,12H,1,3-4,10-11H2.
What are the key properties of [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate?
[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate has a molecular weight of 383.49 g/mol, XLogP of 4.33, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 46826731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).