C21H20BrFN2O4 — CID 46828593
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]butanamide (PubChem CID 46828593) has the molecular formula C21H20BrFN2O4 and a molecular weight of 463.30 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 46828593 |
| Molecular Formula | C21H20BrFN2O4 |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]butanamide |
| SMILES | COc1ccc(C(C)NC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)cc1F |
| InChI | InChI=1S/C21H20BrFN2O4/c1-12(13-5-8-18(29-2)17(23)10-13)24-19(26)4-3-9-25-20(27)15-7-6-14(22)11-16(15)21(25)28/h5-8,10-12H,3-4,9H2,1-2H3,(H,24,26) |
| InChIKey | LFELJALZVVJYON-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|