C21H38N3NaO4 — CID 46830056
sodium 2-[[(Z)-16-(ethylcarbamoylamino)hexadec-11-enoyl]amino]acetate (PubChem CID 46830056) has the molecular formula C21H38N3NaO4 and a molecular weight of 419.54 g/mol. Its IUPAC name is sodium 2-[[(Z)-16-(ethylcarbamoylamino)hexadec-11-enoyl]amino]acetate.
| Compound Name | sodium 2-[[(Z)-16-(ethylcarbamoylamino)hexadec-11-enoyl]amino]acetate |
|---|---|
| PubChem CID | 46830056 |
| Molecular Formula | C21H38N3NaO4 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | sodium 2-[[(Z)-16-(ethylcarbamoylamino)hexadec-11-enoyl]amino]acetate |
| SMILES | CCNC(=O)NCCCC/C=C\CCCCCCCCCC(=O)NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H39N3O4.Na/c1-2-22-21(28)23-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-19(25)24-18-20(26)27;/h7,9H,2-6,8,10-18H2,1H3,(H,24,25)(H,26,27)(H2,22,23,28);/q;+1/p-1/b9-7-; |
| InChIKey | SPVYKPUTXHPANM-VILQZVERSA-M |
| XLogP | -0.59 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|