C28H37NO7 — CID 46830314
(3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-(7-hydroxy-6,6-dimethyl-5-oxo-7-phenylhept-1-ynyl)-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylic acid (PubChem CID 46830314) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-(7-hydroxy-6,6-dimethyl-5-oxo-7-phenylhept-1-ynyl)-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylic acid.
| Compound Name | (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-(7-hydroxy-6,6-dimethyl-5-oxo-7-phenylhept-1-ynyl)-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylic acid |
|---|---|
| PubChem CID | 46830314 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (3R,7S,7aR)-3-tert-butyl-7-hydroxy-7-(7-hydroxy-6,6-dimethyl-5-oxo-7-phenylhept-1-ynyl)-6,6-dimethyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylic acid |
| SMILES | CC(C)(C(=O)CCC#C[C@]1(O)C(C)(C)C(=O)N2[C@@H](C(C)(C)C)OC[C@@]21C(=O)O)C(O)c1ccccc1 |
| InChI | InChI=1S/C28H37NO7/c1-24(2,3)22-29-21(32)26(6,7)28(35,27(29,17-36-22)23(33)34)16-12-11-15-19(30)25(4,5)20(31)18-13-9-8-10-14-18/h8-10,13-14,20,22,31,35H,11,15,17H2,1-7H3,(H,33,34)/t20?,22-,27+,28+/m1/s1 |
| InChIKey | FSVMYUPUQJAOIO-JADWYYMLSA-N |
| XLogP | 2.92 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|