C31H27ClN6O2 — CID 46832078
[4-[4-[[6-(2-chloro-5-hydroxyphenyl)-8-methylquinazolin-2-yl]amino]phenyl]piperazin-1-yl]-pyridin-2-ylmethanone (PubChem CID 46832078) has the molecular formula C31H27ClN6O2 and a molecular weight of 551.05 g/mol. Its IUPAC name is [4-[4-[[6-(2-chloro-5-hydroxyphenyl)-8-methylquinazolin-2-yl]amino]phenyl]piperazin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[4-[[6-(2-chloro-5-hydroxyphenyl)-8-methylquinazolin-2-yl]amino]phenyl]piperazin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 46832078 |
| Molecular Formula | C31H27ClN6O2 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [4-[4-[[6-(2-chloro-5-hydroxyphenyl)-8-methylquinazolin-2-yl]amino]phenyl]piperazin-1-yl]-pyridin-2-ylmethanone |
| SMILES | Cc1cc(-c2cc(O)ccc2Cl)cc2cnc(Nc3ccc(N4CCN(C(=O)c5ccccn5)CC4)cc3)nc12 |
| InChI | InChI=1S/C31H27ClN6O2/c1-20-16-21(26-18-25(39)9-10-27(26)32)17-22-19-34-31(36-29(20)22)35-23-5-7-24(8-6-23)37-12-14-38(15-13-37)30(40)28-4-2-3-11-33-28/h2-11,16-19,39H,12-15H2,1H3,(H,34,35,36) |
| InChIKey | MPNPFEPBTPBOAQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|