C22H24N4O4S — CID 46833977
6-amino-1-cyclopropyl-7-[(4E)-4-hydroxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 46833977) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 6-amino-1-cyclopropyl-7-[(4E)-4-hydroxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-amino-1-cyclopropyl-7-[(4E)-4-hydroxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 46833977 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 6-amino-1-cyclopropyl-7-[(4E)-4-hydroxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(N2CCC3=C(C2)/C(=N/O)CCS3)c(N)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C22H24N4O4S/c1-11-19-13(21(27)15(22(28)29)10-26(19)12-2-3-12)8-16(23)20(11)25-6-4-18-14(9-25)17(24-30)5-7-31-18/h8,10,12,30H,2-7,9,23H2,1H3,(H,28,29)/b24-17+ |
| InChIKey | DKYAXLCBIGJBIF-JJIBRWJFSA-N |
| XLogP | 3.36 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|