C22H22FN3O4S — CID 46832490
1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 46832490) has the molecular formula C22H22FN3O4S and a molecular weight of 443.50 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 46832490 |
| Molecular Formula | C22H22FN3O4S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CO/N=C1\CCSC2=C1CN(c1cc3c(cc1F)c(=O)c(C(=O)O)cn3C1CC1)CC2 |
| InChI | InChI=1S/C22H22FN3O4S/c1-30-24-17-5-7-31-20-4-6-25(10-14(17)20)19-9-18-13(8-16(19)23)21(27)15(22(28)29)11-26(18)12-2-3-12/h8-9,11-12H,2-7,10H2,1H3,(H,28,29)/b24-17+ |
| InChIKey | JTCMIMCNZVQCHK-JJIBRWJFSA-N |
| XLogP | 3.78 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|