C24H26FN3O4S — CID 46832216
ethyl 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylate (PubChem CID 46832216) has the molecular formula C24H26FN3O4S and a molecular weight of 471.55 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 46832216 |
| Molecular Formula | C24H26FN3O4S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | ethyl 1-cyclopropyl-6-fluoro-7-[(4E)-4-methoxyimino-3,5,7,8-tetrahydro-2H-thiopyrano[3,2-c]pyridin-6-yl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2cc(N3CCC4=C(C3)/C(=N/OC)CCS4)c(F)cc2c1=O |
| InChI | InChI=1S/C24H26FN3O4S/c1-3-32-24(30)17-13-28(14-4-5-14)20-11-21(18(25)10-15(20)23(17)29)27-8-6-22-16(12-27)19(26-31-2)7-9-33-22/h10-11,13-14H,3-9,12H2,1-2H3/b26-19+ |
| InChIKey | DDYOVFQRKSPUFC-LGUFXXKBSA-N |
| XLogP | 4.26 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|