C16H27F3O3Si — CID 46837217
[6-[tert-butyl(dimethyl)silyl]oxy-7,7,7-trifluorohept-1-en-4-yl] prop-2-enoate (PubChem CID 46837217) has the molecular formula C16H27F3O3Si and a molecular weight of 352.47 g/mol. Its IUPAC name is [6-[tert-butyl(dimethyl)silyl]oxy-7,7,7-trifluorohept-1-en-4-yl] prop-2-enoate.
| Compound Name | [6-[tert-butyl(dimethyl)silyl]oxy-7,7,7-trifluorohept-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 46837217 |
| Molecular Formula | C16H27F3O3Si |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [6-[tert-butyl(dimethyl)silyl]oxy-7,7,7-trifluorohept-1-en-4-yl] prop-2-enoate |
| SMILES | C=CCC(CC(O[Si](C)(C)C(C)(C)C)C(F)(F)F)OC(=O)C=C |
| InChI | InChI=1S/C16H27F3O3Si/c1-8-10-12(21-14(20)9-2)11-13(16(17,18)19)22-23(6,7)15(3,4)5/h8-9,12-13H,1-2,10-11H2,3-7H3 |
| InChIKey | UJYLRCBIPITDOU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|