C14H23F3O3Si — CID 46837223
2-[2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,3-dihydropyran-6-one (PubChem CID 46837223) has the molecular formula C14H23F3O3Si and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,3-dihydropyran-6-one.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 46837223 |
| Molecular Formula | C14H23F3O3Si |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC1CC=CC(=O)O1)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O3Si/c1-13(2,3)21(4,5)20-11(14(15,16)17)9-10-7-6-8-12(18)19-10/h6,8,10-11H,7,9H2,1-5H3 |
| InChIKey | KYPYMVMWRCELSV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|