C21H37F3O3Si — CID 141012783
ethyl 12,12,12-trifluoro-11-methyl-11-triethylsilyloxydodeca-2,9-dienoate (PubChem CID 141012783) has the molecular formula C21H37F3O3Si and a molecular weight of 422.60 g/mol. Its IUPAC name is ethyl 12,12,12-trifluoro-11-methyl-11-triethylsilyloxydodeca-2,9-dienoate.
| Compound Name | ethyl 12,12,12-trifluoro-11-methyl-11-triethylsilyloxydodeca-2,9-dienoate |
|---|---|
| PubChem CID | 141012783 |
| Molecular Formula | C21H37F3O3Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | ethyl 12,12,12-trifluoro-11-methyl-11-triethylsilyloxydodeca-2,9-dienoate |
| SMILES | CCOC(=O)C=CCCCCCC=CC(C)(O[Si](CC)(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C21H37F3O3Si/c1-6-26-19(25)17-15-13-11-10-12-14-16-18-20(5,21(22,23)24)27-28(7-2,8-3)9-4/h15-18H,6-14H2,1-5H3 |
| InChIKey | NGFWACZZSAMUCM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|