C19H36O3Si — CID 16745113
[(3R,4S)-4-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl] prop-2-enoate (PubChem CID 16745113) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is [(3R,4S)-4-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl] prop-2-enoate.
| Compound Name | [(3R,4S)-4-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 16745113 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [(3R,4S)-4-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C=C |
| InChI | InChI=1S/C19H36O3Si/c1-10-17(9)18(22-19(20)11-2)12-13-21-23(14(3)4,15(5)6)16(7)8/h10-11,14-18H,1-2,12-13H2,3-9H3/t17-,18+/m0/s1 |
| InChIKey | YQMRZSGVMIYCBF-ZWKOTPCHSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|