C17H10Cl3N — CID 46837804
3,4,5-trichloro-2,6-diphenylpyridine (PubChem CID 46837804) has the molecular formula C17H10Cl3N and a molecular weight of 334.63 g/mol. Its IUPAC name is 3,4,5-trichloro-2,6-diphenylpyridine.
| Compound Name | 3,4,5-trichloro-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 46837804 |
| Molecular Formula | C17H10Cl3N |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 3,4,5-trichloro-2,6-diphenylpyridine |
| SMILES | Clc1c(-c2ccccc2)nc(-c2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H10Cl3N/c18-13-14(19)16(11-7-3-1-4-8-11)21-17(15(13)20)12-9-5-2-6-10-12/h1-10H |
| InChIKey | LVOIXUFCFNPORW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |