C16H31NS2Sn — CID 46840003
tributyl-(2-methylsulfanyl-1,3-thiazol-4-yl)stannane (PubChem CID 46840003) has the molecular formula C16H31NS2Sn and a molecular weight of 420.28 g/mol. Its IUPAC name is tributyl-(2-methylsulfanyl-1,3-thiazol-4-yl)stannane.
| Compound Name | tributyl-(2-methylsulfanyl-1,3-thiazol-4-yl)stannane |
|---|---|
| PubChem CID | 46840003 |
| Molecular Formula | C16H31NS2Sn |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | tributyl-(2-methylsulfanyl-1,3-thiazol-4-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1csc(SC)n1 |
| InChI | InChI=1S/C4H4NS2.3C4H9.Sn/c1-6-4-5-2-3-7-4;3*1-3-4-2;/h3H,1H3;3*1,3-4H2,2H3; |
| InChIKey | DNYQPVUGIZBXHX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |