C17H33NOSSn — CID 2763265
tributyl-(2-ethoxy-1,3-thiazol-4-yl)stannane (PubChem CID 2763265) has the molecular formula C17H33NOSSn and a molecular weight of 418.24 g/mol. Its IUPAC name is tributyl-(2-ethoxy-1,3-thiazol-4-yl)stannane.
| Compound Name | tributyl-(2-ethoxy-1,3-thiazol-4-yl)stannane |
|---|---|
| PubChem CID | 2763265 |
| Molecular Formula | C17H33NOSSn |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | tributyl-(2-ethoxy-1,3-thiazol-4-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1csc(OCC)n1 |
| InChI | InChI=1S/C5H6NOS.3C4H9.Sn/c1-2-7-5-6-3-4-8-5;3*1-3-4-2;/h4H,2H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | NBICALVSSSYBKT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |