C23H34N2O7 — CID 46840214
(2S,3R,4S,5S,6R)-2-[4-[dideuterio-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46840214) has the molecular formula C23H34N2O7 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-[dideuterio-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-[dideuterio-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46840214 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[dideuterio-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [2H]C([2H])(c1ccc(OC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])cc1)c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn(C(C)C)c1C |
| InChI | InChI=1S/C23H34N2O7/c1-12(2)25-14(5)17(10-15-6-8-16(9-7-15)30-13(3)4)22(24-25)32-23-21(29)20(28)19(27)18(11-26)31-23/h6-9,12-13,18-21,23,26-29H,10-11H2,1-5H3/t18-,19-,20+,21-,23+/m1/s1/i3D3,4D3,10D2,13D |
| InChIKey | GSINGUMRKGRYJP-GZBYPUOBSA-N |
| XLogP | 1.33 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |