C27H38N2O4 — CID 46843352
2-[3,4-bis(trideuteriomethoxy)phenyl]-5-[2-(3,4-dimethoxyphenyl)ethyl-(trideuteriomethyl)amino]-2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pentanenitrile (PubChem CID 46843352) has the molecular formula C27H38N2O4 and a molecular weight of 469.70 g/mol. Its IUPAC name is 2-[3,4-bis(trideuteriomethoxy)phenyl]-5-[2-(3,4-dimethoxyphenyl)ethyl-(trideuteriomethyl)amino]-2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pentanenitrile.
| Compound Name | 2-[3,4-bis(trideuteriomethoxy)phenyl]-5-[2-(3,4-dimethoxyphenyl)ethyl-(trideuteriomethyl)amino]-2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 46843352 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.38 |
| IUPAC Name | 2-[3,4-bis(trideuteriomethoxy)phenyl]-5-[2-(3,4-dimethoxyphenyl)ethyl-(trideuteriomethyl)amino]-2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pentanenitrile |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C(C#N)(CCCN(CCc2ccc(OC)c(OC)c2)C([2H])([2H])[2H])C(C([2H])([2H])[2H])C([2H])([2H])[2H])cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C27H38N2O4/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6/h9-12,17-18,20H,8,13-16H2,1-7H3/i1D3,2D3,3D3,5D3,7D3 |
| InChIKey | SGTNSNPWRIOYBX-VDFVBYAVSA-N |
| XLogP | 5.09 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |