C19H22FN3O3 — CID 46844643
N-ethyl-3-(3-fluoro-2-methylphenoxy)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboxamide (PubChem CID 46844643) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-ethyl-3-(3-fluoro-2-methylphenoxy)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboxamide.
| Compound Name | N-ethyl-3-(3-fluoro-2-methylphenoxy)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 46844643 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-ethyl-3-(3-fluoro-2-methylphenoxy)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboxamide |
| SMILES | CCN(C(=O)N1CC(Oc2cccc(F)c2C)C1)c1ccc(OC)nc1 |
| InChI | InChI=1S/C19H22FN3O3/c1-4-23(14-8-9-18(25-3)21-10-14)19(24)22-11-15(12-22)26-17-7-5-6-16(20)13(17)2/h5-10,15H,4,11-12H2,1-3H3 |
| InChIKey | OXVKAENYXSMWHO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |