C30H33NO4Si — CID 46846086
benzyl (3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 46846086) has the molecular formula C30H33NO4Si and a molecular weight of 499.68 g/mol. Its IUPAC name is benzyl (3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 46846086 |
| Molecular Formula | C30H33NO4Si |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | benzyl (3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC(=O)N(C(=O)OCc2ccccc2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NO4Si/c1-30(2,3)36(26-15-9-5-10-16-26,27-17-11-6-12-18-27)35-23-25-19-20-28(32)31(21-25)29(33)34-22-24-13-7-4-8-14-24/h4-20,25H,21-23H2,1-3H3/t25-/m0/s1 |
| InChIKey | XLLSOAFBHFREDN-VWLOTQADSA-N |
| XLogP | 4.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|