C36H45NO5Si — CID 71817266
tert-butyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate (PubChem CID 71817266) has the molecular formula C36H45NO5Si and a molecular weight of 599.84 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 71817266 |
| Molecular Formula | C36H45NO5Si |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | tert-butyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H45NO5Si/c1-34(2,3)41-33(39)37-30(31(24-25-32(37)38)42-43(7,8)35(4,5)6)26-40-36(27-18-12-9-13-19-27,28-20-14-10-15-21-28)29-22-16-11-17-23-29/h9-25,30-31H,26H2,1-8H3/t30-,31+/m0/s1 |
| InChIKey | BEKFIMRZTDTZAV-IOWSJCHKSA-N |
| XLogP | 8.09 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|