C33H37NO6 — CID 135070428
methyl (E)-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-trityloxyhept-2-enoate (PubChem CID 135070428) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is methyl (E)-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-trityloxyhept-2-enoate.
| Compound Name | methyl (E)-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-trityloxyhept-2-enoate |
|---|---|
| PubChem CID | 135070428 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | methyl (E)-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-7-trityloxyhept-2-enoate |
| SMILES | COC(=O)/C=C/CCC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)N(C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H37NO6/c1-32(2,3)40-31(37)34(25-35)29(22-14-15-23-30(36)38-4)24-39-33(26-16-8-5-9-17-26,27-18-10-6-11-19-27)28-20-12-7-13-21-28/h5-13,15-21,23,25,29H,14,22,24H2,1-4H3/b23-15+ |
| InChIKey | JSUAKKLTZXNIPM-HZHRSRAPSA-N |
| XLogP | 6.27 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|