C44H53NO4Si — CID 134852815
(4S)-3-[(E,5S)-5-[tert-butyl(diphenyl)silyl]oxydec-2-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 134852815) has the molecular formula C44H53NO4Si and a molecular weight of 688.00 g/mol. Its IUPAC name is (4S)-3-[(E,5S)-5-[tert-butyl(diphenyl)silyl]oxydec-2-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,5S)-5-[tert-butyl(diphenyl)silyl]oxydec-2-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134852815 |
| Molecular Formula | C44H53NO4Si |
| Molecular Weight | 688.00 g/mol |
| Exact Mass | 687.37 |
| IUPAC Name | (4S)-3-[(E,5S)-5-[tert-butyl(diphenyl)silyl]oxydec-2-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@@H](C/C=C/C(=O)N1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H53NO4Si/c1-7-8-13-27-37(49-50(43(4,5)6,38-29-18-11-19-30-38)39-31-20-12-21-32-39)28-22-33-40(46)45-41(34(2)3)44(48-42(45)47,35-23-14-9-15-24-35)36-25-16-10-17-26-36/h9-12,14-26,29-34,37,41H,7-8,13,27-28H2,1-6H3/b33-22+/t37-,41-/m0/s1 |
| InChIKey | HQOVHTAQHPCLLC-LVZOBRCSSA-N |
| XLogP | 9.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.00 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|