C33H39NO5Si — CID 135070432
benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxooct-5-en-2-yl]-N-formylcarbamate (PubChem CID 135070432) has the molecular formula C33H39NO5Si and a molecular weight of 557.76 g/mol. Its IUPAC name is benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxooct-5-en-2-yl]-N-formylcarbamate.
| Compound Name | benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxooct-5-en-2-yl]-N-formylcarbamate |
|---|---|
| PubChem CID | 135070432 |
| Molecular Formula | C33H39NO5Si |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxooct-5-en-2-yl]-N-formylcarbamate |
| SMILES | CC(=O)/C=C/CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H39NO5Si/c1-27(36)16-14-15-19-29(34(26-35)32(37)38-24-28-17-8-5-9-18-28)25-39-40(33(2,3)4,30-20-10-6-11-21-30)31-22-12-7-13-23-31/h5-14,16-18,20-23,26,29H,15,19,24-25H2,1-4H3/b16-14+ |
| InChIKey | ZKJRRZKYFBANPP-JQIJEIRASA-N |
| XLogP | 5.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|