C34H42N2O6Si — CID 135070434
benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-[methoxy(methyl)amino]-7-oxohept-5-en-2-yl]-N-formylcarbamate (PubChem CID 135070434) has the molecular formula C34H42N2O6Si and a molecular weight of 602.80 g/mol. Its IUPAC name is benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-[methoxy(methyl)amino]-7-oxohept-5-en-2-yl]-N-formylcarbamate.
| Compound Name | benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-[methoxy(methyl)amino]-7-oxohept-5-en-2-yl]-N-formylcarbamate |
|---|---|
| PubChem CID | 135070434 |
| Molecular Formula | C34H42N2O6Si |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | benzyl N-[(E)-1-[tert-butyl(diphenyl)silyl]oxy-7-[methoxy(methyl)amino]-7-oxohept-5-en-2-yl]-N-formylcarbamate |
| SMILES | CON(C)C(=O)/C=C/CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H42N2O6Si/c1-34(2,3)43(30-20-11-7-12-21-30,31-22-13-8-14-23-31)42-26-29(19-15-16-24-32(38)35(4)40-5)36(27-37)33(39)41-25-28-17-9-6-10-18-28/h6-14,16-18,20-24,27,29H,15,19,25-26H2,1-5H3/b24-16+ |
| InChIKey | ASQQZJNEPDPFNP-LFVJCYFKSA-N |
| XLogP | 5.08 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|