C17H32OSi — CID 46846091
[(1S,3aS,7aS)-3a-methyl-4-methylidene-2,3,5,6,7,7a-hexahydro-1H-inden-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 46846091) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is [(1S,3aS,7aS)-3a-methyl-4-methylidene-2,3,5,6,7,7a-hexahydro-1H-inden-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aS,7aS)-3a-methyl-4-methylidene-2,3,5,6,7,7a-hexahydro-1H-inden-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 46846091 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [(1S,3aS,7aS)-3a-methyl-4-methylidene-2,3,5,6,7,7a-hexahydro-1H-inden-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CCC[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C17H32OSi/c1-13-9-8-10-14-15(11-12-17(13,14)5)18-19(6,7)16(2,3)4/h14-15H,1,8-12H2,2-7H3/t14-,15+,17-/m1/s1 |
| InChIKey | KKHPANJFPXZGQN-HLLBOEOZSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|