C31H29ClN6O3 — CID 46847492
2-[2-(2-chlorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]-N-[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-yl]acetamide (PubChem CID 46847492) has the molecular formula C31H29ClN6O3 and a molecular weight of 569.07 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]-N-[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-yl]acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]-N-[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-yl]acetamide |
|---|---|
| PubChem CID | 46847492 |
| Molecular Formula | C31H29ClN6O3 |
| Molecular Weight | 569.07 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]-N-[(3S)-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-yl]acetamide |
| SMILES | O=C(CN1C(=O)C(c2ccccc2Cl)=NC12CCCCCC2)Nc1cnc2c(c1)C[C@@]1(C2)C(=O)Nc2ncccc21 |
| InChI | InChI=1S/C31H29ClN6O3/c32-23-10-4-3-8-21(23)26-28(40)38(31(37-26)11-5-1-2-6-12-31)18-25(39)35-20-14-19-15-30(16-24(19)34-17-20)22-9-7-13-33-27(22)36-29(30)41/h3-4,7-10,13-14,17H,1-2,5-6,11-12,15-16,18H2,(H,35,39)(H,33,36,41)/t30-/m0/s1 |
| InChIKey | PUXWTQCSBXHBDB-PMERELPUSA-N |
| XLogP | 4.44 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.07 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |