C32H28FN5O2 — CID 58553922
3'-[3-[2-(2-fluorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]prop-1-ynyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one (PubChem CID 58553922) has the molecular formula C32H28FN5O2 and a molecular weight of 533.61 g/mol. Its IUPAC name is 3'-[3-[2-(2-fluorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]prop-1-ynyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one.
| Compound Name | 3'-[3-[2-(2-fluorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]prop-1-ynyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one |
|---|---|
| PubChem CID | 58553922 |
| Molecular Formula | C32H28FN5O2 |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 3'-[3-[2-(2-fluorophenyl)-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl]prop-1-ynyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one |
| SMILES | O=C1C(c2ccccc2F)=NC2(CCCCCC2)N1CC#Cc1cnc2c(c1)CC1(C2)C(=O)Nc2ncccc21 |
| InChI | InChI=1S/C32H28FN5O2/c33-25-12-4-3-10-23(25)27-29(39)38(32(37-27)13-5-1-2-6-14-32)16-8-9-21-17-22-18-31(19-26(22)35-20-21)24-11-7-15-34-28(24)36-30(31)40/h3-4,7,10-12,15,17,20H,1-2,5-6,13-14,16,18-19H2,(H,34,36,40) |
| InChIKey | PYRIXPSRUXQXBG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|