C19H29BrN4O4 — CID 46849962
ditert-butyl 2-(5-bromo-2-pyridinyl)-1,2,5-triazepane-1,5-dicarboxylate (PubChem CID 46849962) has the molecular formula C19H29BrN4O4 and a molecular weight of 457.37 g/mol. Its IUPAC name is ditert-butyl 2-(5-bromo-2-pyridinyl)-1,2,5-triazepane-1,5-dicarboxylate.
| Compound Name | ditert-butyl 2-(5-bromo-2-pyridinyl)-1,2,5-triazepane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 46849962 |
| Molecular Formula | C19H29BrN4O4 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | ditert-butyl 2-(5-bromo-2-pyridinyl)-1,2,5-triazepane-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)N(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C19H29BrN4O4/c1-18(2,3)27-16(25)22-9-11-23(15-8-7-14(20)13-21-15)24(12-10-22)17(26)28-19(4,5)6/h7-8,13H,9-12H2,1-6H3 |
| InChIKey | ZJCFQZLUJSTXIW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |