C25H25N5O6S — CID 46851822
1-[3-(4-hydroxypiperidine-1-carboximidoyl)phenyl]-3-[4-(4-nitrophenyl)sulfonylphenyl]urea (PubChem CID 46851822) has the molecular formula C25H25N5O6S and a molecular weight of 523.57 g/mol. Its IUPAC name is 1-[3-(4-hydroxypiperidine-1-carboximidoyl)phenyl]-3-[4-(4-nitrophenyl)sulfonylphenyl]urea.
| Compound Name | 1-[3-(4-hydroxypiperidine-1-carboximidoyl)phenyl]-3-[4-(4-nitrophenyl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 46851822 |
| Molecular Formula | C25H25N5O6S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 1-[3-(4-hydroxypiperidine-1-carboximidoyl)phenyl]-3-[4-(4-nitrophenyl)sulfonylphenyl]urea |
| SMILES | [H]/N=C(/c1cccc(NC(=O)Nc2ccc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)c1)N1CCC(O)CC1 |
| InChI | InChI=1S/C25H25N5O6S/c26-24(29-14-12-21(31)13-15-29)17-2-1-3-19(16-17)28-25(32)27-18-4-8-22(9-5-18)37(35,36)23-10-6-20(7-11-23)30(33)34/h1-11,16,21,26,31H,12-15H2,(H2,27,28,32)/b26-24- |
| InChIKey | PEELULYAXYPFTB-LCUIJRPUSA-N |
| XLogP | 3.85 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|