C33H40N4O4 — CID 46853768
2-anilino-N-[(2S)-1-[[(2S)-4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 46853768) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is 2-anilino-N-[(2S)-1-[[(2S)-4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-anilino-N-[(2S)-1-[[(2S)-4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 46853768 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-anilino-N-[(2S)-1-[[(2S)-4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccccc1Nc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C33H40N4O4/c1-22(2)20-28(36-30(39)25-18-12-13-19-26(25)34-24-16-10-7-11-17-24)31(40)35-27(21-23-14-8-6-9-15-23)29(38)32(41)37-33(3,4)5/h6-19,22,27-28,34H,20-21H2,1-5H3,(H,35,40)(H,36,39)(H,37,41)/t27-,28-/m0/s1 |
| InChIKey | PBHKPXGBTQQUTD-NSOVKSMOSA-N |
| XLogP | 4.79 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|