C25H33N5O4 — CID 138470037
N-[1-[[4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrimidine-5-carboxamide (PubChem CID 138470037) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[1-[[4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-[1-[[4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 138470037 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[1-[[4-(tert-butylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrimidine-5-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1cncnc1)C(=O)NC(Cc1ccccc1)C(=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H33N5O4/c1-16(2)11-20(29-22(32)18-13-26-15-27-14-18)23(33)28-19(12-17-9-7-6-8-10-17)21(31)24(34)30-25(3,4)5/h6-10,13-16,19-20H,11-12H2,1-5H3,(H,28,33)(H,29,32)(H,30,34) |
| InChIKey | DOQHHCHPRZEWSN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|