C29H31FN4O4 — CID 46853771
N-[(2S)-1-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-(3-fluoroanilino)benzamide (PubChem CID 46853771) has the molecular formula C29H31FN4O4 and a molecular weight of 518.59 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-(3-fluoroanilino)benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-(3-fluoroanilino)benzamide |
|---|---|
| PubChem CID | 46853771 |
| Molecular Formula | C29H31FN4O4 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | N-[(2S)-1-[[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-(3-fluoroanilino)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccccc1Nc1cccc(F)c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(N)=O |
| InChI | InChI=1S/C29H31FN4O4/c1-18(2)15-25(29(38)33-24(26(35)27(31)36)16-19-9-4-3-5-10-19)34-28(37)22-13-6-7-14-23(22)32-21-12-8-11-20(30)17-21/h3-14,17-18,24-25,32H,15-16H2,1-2H3,(H2,31,36)(H,33,38)(H,34,37)/t24-,25-/m0/s1 |
| InChIKey | SWNPFUCPOQMVAB-DQEYMECFSA-N |
| XLogP | 3.50 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|