About S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate
S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate (PubChem CID 46854146) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate.
Molecular Properties
| Compound Name | S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate |
| PubChem CID | 46854146 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate |
| SMILES | C=C[C@@H](CCC)SC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H17NOS/c1-3-8-12(4-2)16-13(15)14-11-9-6-5-7-10-11/h4-7,9-10,12H,2-3,8H2,1H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | BJSQEGCBJDGXAJ-LBPRGKRZSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate?
The IUPAC name of S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate (CID 46854146) is S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate.
What is the SMILES notation for S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate?
The canonical SMILES for S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate is C=C[C@@H](CCC)SC(=O)Nc1ccccc1.
What is the InChIKey of S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate?
The InChIKey is BJSQEGCBJDGXAJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H17NOS/c1-3-8-12(4-2)16-13(15)14-11-9-6-5-7-10-11/h4-7,9-10,12H,2-3,8H2,1H3,(H,14,15)/t12-/m0/s1.
What are the key properties of S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate?
S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate has a molecular weight of 235.35 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(3R)-hex-1-en-3-yl] N-phenylcarbamothioate is sourced from PubChem (CID 46854146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).