C17H30O2 — CID 46854481
4-[(2S,3R)-3-undecyloxiran-2-yl]but-2-yn-1-ol (PubChem CID 46854481) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 4-[(2S,3R)-3-undecyloxiran-2-yl]but-2-yn-1-ol.
| Compound Name | 4-[(2S,3R)-3-undecyloxiran-2-yl]but-2-yn-1-ol |
|---|---|
| PubChem CID | 46854481 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 4-[(2S,3R)-3-undecyloxiran-2-yl]but-2-yn-1-ol |
| SMILES | CCCCCCCCCCC[C@H]1O[C@H]1CC#CCO |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-13-16-17(19-16)14-11-12-15-18/h16-18H,2-10,13-15H2,1H3/t16-,17+/m1/s1 |
| InChIKey | UIXHCBNQYCWWMS-SJORKVTESA-N |
| XLogP | 4.06 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|