C12H19BrO — CID 11108037
(2R,3S)-2-(3-bromoprop-2-ynyl)-3-heptyloxirane (PubChem CID 11108037) has the molecular formula C12H19BrO and a molecular weight of 259.19 g/mol. Its IUPAC name is (2R,3S)-2-(3-bromoprop-2-ynyl)-3-heptyloxirane.
| Compound Name | (2R,3S)-2-(3-bromoprop-2-ynyl)-3-heptyloxirane |
|---|---|
| PubChem CID | 11108037 |
| Molecular Formula | C12H19BrO |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (2R,3S)-2-(3-bromoprop-2-ynyl)-3-heptyloxirane |
| SMILES | CCCCCCC[C@@H]1O[C@@H]1CC#CBr |
| InChI | InChI=1S/C12H19BrO/c1-2-3-4-5-6-8-11-12(14-11)9-7-10-13/h11-12H,2-6,8-9H2,1H3/t11-,12+/m0/s1 |
| InChIKey | JFLMGVAYQFITFU-NWDGAFQWSA-N |
| XLogP | 3.86 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|