C17H26O2 — CID 162849739
(3S)-8-[(2R,3S)-3-heptyloxiran-2-yl]octa-4,6-diyn-3-ol (PubChem CID 162849739) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (3S)-8-[(2R,3S)-3-heptyloxiran-2-yl]octa-4,6-diyn-3-ol.
| Compound Name | (3S)-8-[(2R,3S)-3-heptyloxiran-2-yl]octa-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 162849739 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (3S)-8-[(2R,3S)-3-heptyloxiran-2-yl]octa-4,6-diyn-3-ol |
| SMILES | CCCCCCC[C@@H]1O[C@@H]1CC#CC#C[C@@H](O)CC |
| InChI | InChI=1S/C17H26O2/c1-3-5-6-7-10-13-16-17(19-16)14-11-8-9-12-15(18)4-2/h15-18H,3-7,10,13-14H2,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | WDZQEROINMBCOK-YESZJQIVSA-N |
| XLogP | 3.28 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|