C16H24ClNO2 — CID 46854505
tert-butyl (2S)-2-amino-2-benzyl-5-chloropentanoate (PubChem CID 46854505) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-2-benzyl-5-chloropentanoate.
| Compound Name | tert-butyl (2S)-2-amino-2-benzyl-5-chloropentanoate |
|---|---|
| PubChem CID | 46854505 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl (2S)-2-amino-2-benzyl-5-chloropentanoate |
| SMILES | CC(C)(C)OC(=O)[C@](N)(CCCCl)Cc1ccccc1 |
| InChI | InChI=1S/C16H24ClNO2/c1-15(2,3)20-14(19)16(18,10-7-11-17)12-13-8-5-4-6-9-13/h4-6,8-9H,7,10-12,18H2,1-3H3/t16-/m0/s1 |
| InChIKey | BTWYFDIPRZRTGS-INIZCTEOSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|