C18H28N2O4 — CID 141197192
2,6-diamino-6-benzyl-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid (PubChem CID 141197192) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2,6-diamino-6-benzyl-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid.
| Compound Name | 2,6-diamino-6-benzyl-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 141197192 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2,6-diamino-6-benzyl-7-[(2-methylpropan-2-yl)oxy]-7-oxoheptanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCC(N)C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C18H28N2O4/c1-17(2,3)24-16(23)18(20,11-7-10-14(19)15(21)22)12-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12,19-20H2,1-3H3,(H,21,22) |
| InChIKey | CFLJPZURWQLSGG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |