C30H45NO5Si — CID 173341971
tert-butyl (2S,3S,5R)-5-amino-2,5-dibenzyl-3-(3,3-dimethylbutan-2-yl)-6-oxo-6-silylperoxyhexanoate (PubChem CID 173341971) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R)-5-amino-2,5-dibenzyl-3-(3,3-dimethylbutan-2-yl)-6-oxo-6-silylperoxyhexanoate.
| Compound Name | tert-butyl (2S,3S,5R)-5-amino-2,5-dibenzyl-3-(3,3-dimethylbutan-2-yl)-6-oxo-6-silylperoxyhexanoate |
|---|---|
| PubChem CID | 173341971 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | tert-butyl (2S,3S,5R)-5-amino-2,5-dibenzyl-3-(3,3-dimethylbutan-2-yl)-6-oxo-6-silylperoxyhexanoate |
| SMILES | CC([C@H](C[C@@](N)(Cc1ccccc1)C(=O)OO[SiH3])[C@H](Cc1ccccc1)C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H45NO5Si/c1-21(28(2,3)4)25(20-30(31,27(33)35-36-37)19-23-16-12-9-13-17-23)24(26(32)34-29(5,6)7)18-22-14-10-8-11-15-22/h8-17,21,24-25H,18-20,31H2,1-7,37H3/t21?,24-,25-,30-/m0/s1 |
| InChIKey | LLJJLISMMFNLAY-PIJRDUKDSA-N |
| XLogP | 4.57 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|