C19H26BrN3OS — CID 46861986
2-(2-cyclopentylimino-3,5-dimethyl-1,3-thiazol-4-yl)-N-(4-methylphenyl)acetamide;hydrobromide (PubChem CID 46861986) has the molecular formula C19H26BrN3OS and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-(2-cyclopentylimino-3,5-dimethyl-1,3-thiazol-4-yl)-N-(4-methylphenyl)acetamide;hydrobromide.
| Compound Name | 2-(2-cyclopentylimino-3,5-dimethyl-1,3-thiazol-4-yl)-N-(4-methylphenyl)acetamide;hydrobromide |
|---|---|
| PubChem CID | 46861986 |
| Molecular Formula | C19H26BrN3OS |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-(2-cyclopentylimino-3,5-dimethyl-1,3-thiazol-4-yl)-N-(4-methylphenyl)acetamide;hydrobromide |
| SMILES | Br.Cc1ccc(NC(=O)Cc2c(C)s/c(=N\C3CCCC3)n2C)cc1 |
| InChI | InChI=1S/C19H25N3OS.BrH/c1-13-8-10-16(11-9-13)20-18(23)12-17-14(2)24-19(22(17)3)21-15-6-4-5-7-15;/h8-11,15H,4-7,12H2,1-3H3,(H,20,23);1H/b21-19-; |
| InChIKey | SWTXGDORXQBWHM-WQGAEACMSA-N |
| XLogP | 4.31 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|