C24H39N3S — CID 46862415
N-[2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine (PubChem CID 46862415) has the molecular formula C24H39N3S and a molecular weight of 401.66 g/mol. Its IUPAC name is N-[2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine.
| Compound Name | N-[2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine |
|---|---|
| PubChem CID | 46862415 |
| Molecular Formula | C24H39N3S |
| Molecular Weight | 401.66 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | N-[2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine |
| SMILES | CCn1c(CCNC23CC4CC(CC(C4)C2)C3)cs/c1=N\C1CCCCCC1 |
| InChI | InChI=1S/C24H39N3S/c1-2-27-22(17-28-23(27)26-21-7-5-3-4-6-8-21)9-10-25-24-14-18-11-19(15-24)13-20(12-18)16-24/h17-21,25H,2-16H2,1H3/b26-23- |
| InChIKey | NYIRFDOZTVBBHF-RWEWTDSWSA-N |
| XLogP | 5.29 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|