C25H39N3OS — CID 53258390
N-(1-adamantyl)-2-(2-cycloheptylimino-3-propyl-1,3-thiazol-4-yl)acetamide (PubChem CID 53258390) has the molecular formula C25H39N3OS and a molecular weight of 429.67 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2-cycloheptylimino-3-propyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(1-adamantyl)-2-(2-cycloheptylimino-3-propyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 53258390 |
| Molecular Formula | C25H39N3OS |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | N-(1-adamantyl)-2-(2-cycloheptylimino-3-propyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCCn1c(CC(=O)NC23CC4CC(CC(C4)C2)C3)cs/c1=N\C1CCCCCC1 |
| InChI | InChI=1S/C25H39N3OS/c1-2-9-28-22(17-30-24(28)26-21-7-5-3-4-6-8-21)13-23(29)27-25-14-18-10-19(15-25)12-20(11-18)16-25/h17-21H,2-16H2,1H3,(H,27,29)/b26-24- |
| InChIKey | IDHAIYPCYFENLZ-LCUIJRPUSA-N |
| XLogP | 5.21 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|