C22H33N3OS — CID 53258271
N-(1-adamantyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 53258271) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(1-adamantyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 53258271 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(1-adamantyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cn1c(CC(=O)NC23CC4CC(CC(C4)C2)C3)cs/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C22H33N3OS/c1-25-19(14-27-21(25)23-18-5-3-2-4-6-18)10-20(26)24-22-11-15-7-16(12-22)9-17(8-15)13-22/h14-18H,2-13H2,1H3,(H,24,26)/b23-21- |
| InChIKey | BJPOQEDZAUPTPL-LNVKXUELSA-N |
| XLogP | 3.95 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|