C27H39N3OS — CID 53258392
N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazol-4-yl]acetamide (PubChem CID 53258392) has the molecular formula C27H39N3OS and a molecular weight of 453.70 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 53258392 |
| Molecular Formula | C27H39N3OS |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazol-4-yl]acetamide |
| SMILES | CCn1c(CC(=O)NC23CC4CC(CC(C4)C2)C3)cs/c1=N\C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H39N3OS/c1-2-30-23(9-24(31)28-26-10-17-3-18(11-26)5-19(4-17)12-26)16-32-25(30)29-27-13-20-6-21(14-27)8-22(7-20)15-27/h16-22H,2-15H2,1H3,(H,28,31)/b29-25- |
| InChIKey | LGOQAVXMLWASRC-GNVQSUKOSA-N |
| XLogP | 5.07 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|